| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:Chloroacetic acid-d3
CAS:1796-85-6
Purity:98 atoM % D Package:5G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Chloroacetic acid-d3
CAS:1796-85-6
Purity:98 atom % D Package:5G Remarks:615404-5G
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:CHLOROACETIC ACID (D3, 98%)
CAS:1796-85-6
Remarks:H-16140
|
CHLOROACETIC ACID-D3 manufacturers
|
| | CHLOROACETIC ACID-D3 Basic information |
| | CHLOROACETIC ACID-D3 Chemical Properties |
| Melting point | 60-63 °C (lit.) | | Boiling point | 189 °C (lit.) | | density | 1.630 g/mL | | Fp | 126 °C | | solubility | Water (Slightly) | | form | Solid | | color | White | | Stability: | Hygroscopic | | InChI | 1S/C2H3ClO2/c3-1-2(4)5/h1H2,(H,4,5)/i1D2/hD | | InChIKey | FOCAUTSVDIKZOP-RIAYTAFFSA-N | | SMILES | [2H]OC(=O)C([2H])([2H])Cl | | CAS Number Unlabeled | 79-11-8 |
| Hazard Codes | T,N | | Risk Statements | 25-34-50-23/24/25 | | Safety Statements | 23-37-45-61-63-36/37/39-26 | | RIDADR | UN 1751 6.1/PG 2 | | WGK Germany | 2 | | RTECS | AF8575000 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 3 Dermal
Acute Tox. 3 Oral
Aquatic Acute 1
Skin Corr. 1B |
| | CHLOROACETIC ACID-D3 Usage And Synthesis |
| Uses | A labelled form of chloroacetic acid (C363365) which is used to detect hydrated electron (e-aq) generated in p-benzoquinone/UV process. Chloroacetic Acid-d3 is a useful deuterated building block, used in the synthesis of heavy dl-adrenaline. |
| | CHLOROACETIC ACID-D3 Preparation Products And Raw materials |
|