| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-bromo-N-(pyridin-2-ylmethyl)naphthalene-1-sulfonamide Basic information |
| | 4-bromo-N-(pyridin-2-ylmethyl)naphthalene-1-sulfonamide Chemical Properties |
| Boiling point | 543.6±60.0 °C(Predicted) | | density | 1.544±0.06 g/cm3(Predicted) | | storage temp. | room temp | | solubility | DMSO: >10mg/mL | | form | powder | | pka | 9.27±0.50(Predicted) | | color | white to off-white | | InChI | 1S/C16H13BrN2O2S/c17-15-8-9-16(14-7-2-1-6-13(14)15)22(20,21)19-11-12-5-3-4-10-18-12/h1-10,19H,11H2 | | InChIKey | GJSDYQXOSHKOGX-UHFFFAOYSA-N | | SMILES | Brc1ccc(c2ccccc12)S(=O)(=O)NCc3ccccn3 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2 |
| | 4-bromo-N-(pyridin-2-ylmethyl)naphthalene-1-sulfonamide Usage And Synthesis |
| Uses | Pyrabactin has been used to form a homogeneous complex of PYL3pyrabactin for the protein purification by size-exclusion chromatography. | | Definition | ChEBI: A sulfonamide obtained by formal condensation of the sulfo group of 4-bromonaphthalene-1-sulfonic acid with the exocyclic amino group of 2-pyridylmethylamine. Mimics the action of the abscisic acid, a phytohormone. | | Biochem/physiol Actions | Pyrabactin is a synthetic plant growth inhibitor that acts as a seed-selective abscisic acid (ABA) agonist. Pyrabactin acts through Pyrabactin Resistance 1 (PYR1), the founding member of a family of START proteins called PYR/PYLs, which are necessary for both pyrabactin and ABA signaling in vivo. Eventually, it is hoped to lead to a compound that could be sprayed on crops to protect them from drought. |
| | 4-bromo-N-(pyridin-2-ylmethyl)naphthalene-1-sulfonamide Preparation Products And Raw materials |
|