|
|
| | 2-AMINO-4,5-DIPHENYL-3-FURONITRILE Basic information |
| | 2-AMINO-4,5-DIPHENYL-3-FURONITRILE Chemical Properties |
| Melting point | 201-205 °C (lit.) | | Boiling point | 450.3±45.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -1.91±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C17H12N2O/c18-11-14-15(12-7-3-1-4-8-12)16(20-17(14)19)13-9-5-2-6-10-13/h1-10H,19H2 | | InChIKey | BPFMLOQVCKVCAT-UHFFFAOYSA-N | | SMILES | Nc1oc(-c2ccccc2)c(-c3ccccc3)c1C#N | | CAS DataBase Reference | 5503-73-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-AMINO-4,5-DIPHENYL-3-FURONITRILE Usage And Synthesis |
| | 2-AMINO-4,5-DIPHENYL-3-FURONITRILE Preparation Products And Raw materials |
|