| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 8-Benzyl (S)-2-aminooctanedioate Basic information |
| Product Name: | 8-Benzyl (S)-2-aminooctanedioate | | Synonyms: | L-ALPHA-AMINOSUBERIC ACID OMEGA-BENZYL ESTER;(L)-2-AMINOOCTANEDIOIC ACID-8-BENZYL ESTER;L-A-AMINOSUBERIC ACID OMEGA-BENZYL ESTER;OMEGA-BENZYL (S)-2-AMINOSUBERATE;H-ASU(OBZL)-OH;ω-benzyl (s)-2-aminosuberate;(S)-2-Amino-8-(benzyloxy)-8-oxooctanoic acid;w-Benzyl L-2-aminosuberate | | CAS: | 116052-00-7 | | MF: | C15H21NO4 | | MW: | 279.33 | | EINECS: | | | Product Categories: | | | Mol File: | 116052-00-7.mol |  |
| | 8-Benzyl (S)-2-aminooctanedioate Chemical Properties |
| Melting point | 230-238 °C | | Boiling point | 427.0±45.0 °C(Predicted) | | density | 1.164±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 2.54±0.24(Predicted) | | form | powder | | color | white | | Optical Rotation | [α]20/D +20.0±2°, c = 1% in formic acid | | BRN | 7538626 | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO4/c16-13(15(18)19)9-5-2-6-10-14(17)20-11-12-7-3-1-4-8-12/h1,3-4,7-8,13H,2,5-6,9-11,16H2,(H,18,19)/t13-/m0/s1 | | InChIKey | LHSQENYNJGOZKR-ZDUSSCGKSA-N | | SMILES | N[C@@H](CCCCCC(=O)OCc1ccccc1)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 8-Benzyl (S)-2-aminooctanedioate Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 8-Benzyl (S)-2-aminooctanedioate Preparation Products And Raw materials |
|