| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | cis-7,10,13,16,19-Docosa-tetraenoic acid methyl ester Basic information |
| Product Name: | cis-7,10,13,16,19-Docosa-tetraenoic acid methyl ester | | Synonyms: | cis-7,10,13,16-docosatetraenoic acid*methyl ester;Methyl cis-7,10,13,16-Docosatetraenoate;Methyl 7,10,13,16-docosatetraenoate (all-cis);cis-7,10,13,16-Docosatetraenoic ac;(7Z,10Z,13Z,16Z)-7,10,13,16-Docosatetraenoic acid methyl ester;Methyl 7Z,10Z,13Z,16Z-docosatetraenoate;7,10,13,16-Docosatetraenoicacid, methyl ester, (7Z,10Z,13Z,16Z)-;ABGHYAFHPINIHF-ZKWNWVNESA-N | | CAS: | 13487-42-8 | | MF: | C23H38O2 | | MW: | 346.55 | | EINECS: | | | Product Categories: | Esters;Methyl Esters;Unsaturated fatty acids and derivatives | | Mol File: | 13487-42-8.mol |  |
| | cis-7,10,13,16,19-Docosa-tetraenoic acid methyl ester Chemical Properties |
| Boiling point | 432.1±24.0 °C(Predicted) | | density | 0.897±0.06 g/cm3(Predicted) | | refractive index | 1.4821 (589.3 nm 25℃) | | storage temp. | -20°C | | form | liquid | | InChI | 1S/C23H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-2/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-22H2,1-2H3/b8-7-,11-10-,14-13-,17-16- | | InChIKey | ABGHYAFHPINIHF-ZKWNWVNESA-N | | SMILES | CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCCCC(=O)OC |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | cis-7,10,13,16,19-Docosa-tetraenoic acid methyl ester Usage And Synthesis |
| Uses | cis-7,10,13,16-Docosatetraenoic Acid Methyl Ester is used in oregano essential oil as an inhibitor of higher fatty acid oxidation. |
| | cis-7,10,13,16,19-Docosa-tetraenoic acid methyl ester Preparation Products And Raw materials |
|