| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | MORPHOLINE-2,2,3,3,5,5,6,6-D8 HYDROCHLORIDE Basic information |
| Product Name: | MORPHOLINE-2,2,3,3,5,5,6,6-D8 HYDROCHLORIDE | | Synonyms: | MORPHOLINE-D8 HCL;MORPHOLINE-2,2,3,3,5,5,6,6-D8 HYDROCHLORIDE;Morpholine-d8 Hydrochloride;2,2,3,3,5,5,6,6-octadeuteriomorpholine:hydrochloride;[2H8]-Morpholine Hydrochloride;[2H8]-Morpholine hydrochloride salt;2H8]-Morpholine hydrochlorid;Morpholine-2,2,3,3,5,5,6,6-d8 hydrochloride in methanol | | CAS: | 1107650-56-5 | | MF: | C4HD8NO.ClH | | MW: | 131.63 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | MORPHOLINE-2,2,3,3,5,5,6,6-D8 HYDROCHLORIDE Chemical Properties |
| Melting point | 176 - 177°C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly, Sonicated), Water (Sparingly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C4H9NO.ClH/c1-3-6-4-2-5-1;/h5H,1-4H2;1H/i1D2,2D2,3D2,4D2; | | InChIKey | JXYZHMPRERWTPM-PHHTYKMFSA-N | | SMILES | N1C([2H])([2H])C([2H])([2H])OC([2H])([2H])C1([2H])[2H].Cl |
| | MORPHOLINE-2,2,3,3,5,5,6,6-D8 HYDROCHLORIDE Usage And Synthesis |
| Uses | Morpholine-d8 Hydrochloride is used as a reactant in the synthesis of Moclobemide-d8 (M481002), the labeled analogue of Moclobemide (M481000), a reversible monoamine oxidase inhibitor. |
| | MORPHOLINE-2,2,3,3,5,5,6,6-D8 HYDROCHLORIDE Preparation Products And Raw materials |
|