|
|
| | Methyl 3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl) propionate Basic information |
| Product Name: | Methyl 3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl) propionate | | Synonyms: | Methyl 3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl) propionate;2-(Methoxycarbonyl)ethylboronic acid, pinacol ester;Methyl 3-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)propanoate;[2-(METHOXYCARBONYL)ETHYLBORONIC ACID, PICOL ESTER];Methyl 3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl) propiote;1,3,2-Dioxaborolane-2-propanoic acid, 4,4,5,5-tetramethyl-, methyl ester;3-Methoxy-3-oxopropylboronic Acid Pinacol Ester;Methyl 4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-propanoate | | CAS: | 1150561-77-5 | | MF: | C10H19BO4 | | MW: | 214.07 | | EINECS: | | | Product Categories: | Alkyl;Organoborons | | Mol File: | 1150561-77-5.mol | ![Methyl 3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl) propionate Structure](CAS/GIF/1150561-77-5.gif) |
| | Methyl 3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl) propionate Chemical Properties |
| Boiling point | 242.7±23.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C10H19BO4/c1-9(2)10(3,4)15-11(14-9)7-6-8(12)13-5/h6-7H2,1-5H3 | | InChIKey | SWDXLJYTYJQFJI-UHFFFAOYSA-N | | SMILES | COC(CCB1OC(C)(C(C)(O1)C)C)=O |
| HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | Methyl 3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl) propionate Usage And Synthesis |
| | Methyl 3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl) propionate Preparation Products And Raw materials |
|