| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
Cholesteryl sulfate potassium salt manufacturers
|
| | Cholesteryl sulfate potassium salt Basic information |
| Product Name: | Cholesteryl sulfate potassium salt | | Synonyms: | potassium cholesterol sulfate;POTASSIUM CHOLESTERYL SULFATE;CHOLESTERYL SULFATE, POTASSIUM SALT;cholesteryl potassium sulfate;KCS;CHOLESTEROLPOTASSIUMSULFATE;CHOLESTEROL SULFATE POTASSIUM(KCS);POTASSIUM CHOLESTEROL SULFATE (KCS) | | CAS: | 6614-96-6 | | MF: | C27H45KO4S | | MW: | 504.81 | | EINECS: | | | Product Categories: | | | Mol File: | 6614-96-6.mol |  |
| | Cholesteryl sulfate potassium salt Chemical Properties |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT | | InChIKey | DXURYUGUMKTQBU-KPNWGBFJSA-M | | SMILES | [K+].CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OS([O-])(=O)=O | | CAS DataBase Reference | 6614-96-6(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | Cholesteryl sulfate potassium salt Usage And Synthesis |
| Description | Potassium Cholesteryl Sulfate is the potassium salt of the sulfuric acid ester of Cholesterol. | | Chemical Properties | mp 219-222°C |
| | Cholesteryl sulfate potassium salt Preparation Products And Raw materials |
|