| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4,5-Dichlorophthalic acid Basic information |
| | 4,5-Dichlorophthalic acid Chemical Properties |
| Melting point | 198-200 °C (dec.)(lit.) | | Boiling point | 422.1±45.0 °C(Predicted) | | density | 1.698±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.35±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H4Cl2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14) | | InChIKey | FDOQKGWUMUEJLX-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=CC(Cl)=C(Cl)C=C1C(O)=O | | CAS DataBase Reference | 56962-08-4(CAS DataBase Reference) | | EPA Substance Registry System | 1,2-Benzenedicarboxylic acid, 4,5-dichloro- (56962-08-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2917399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4,5-Dichlorophthalic acid Usage And Synthesis |
| Purification Methods | Crystallise the acid from water. It has been purified by converting to the anhydride, reacting it with boiling EtOH to form the monoethyl ester (m 133-134o) and hydrolysing it back to the diacid (see next entry). [Beilstein 9 III 4205.] |
| | 4,5-Dichlorophthalic acid Preparation Products And Raw materials |
|