|
|
| | 1,3,5-TRIAMINOBENZENE Basic information |
| Product Name: | 1,3,5-TRIAMINOBENZENE | | Synonyms: | TIMTEC-BB SBB000049;1,3,5-TRIAMINOBENZENE;1,3,5-Benzenetriamine;3,5-Diaminoaniline;1,3,5-Triaminobenzene xhydrochloride;sym-Triaminobenzene;Trienathoin;1,3,5-triaMine Benzene | | CAS: | 108-72-5 | | MF: | C6H9N3 | | MW: | 123.16 | | EINECS: | 203-610-7 | | Product Categories: | | | Mol File: | 108-72-5.mol |  |
| | 1,3,5-TRIAMINOBENZENE Chemical Properties |
| Melting point | 84-85℃ | | Boiling point | 219.27°C (rough estimate) | | density | 1.279 | | refractive index | 1.5589 (estimate) | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 5.05±0.10(Predicted) | | color | Dark Brown to Very Dark Brown | | InChI | InChI=1S/C6H9N3/c7-4-1-5(8)3-6(9)2-4/h1-3H,7-9H2 | | InChIKey | RPHKINMPYFJSCF-UHFFFAOYSA-N | | SMILES | C1(N)=CC(N)=CC(N)=C1 | | EPA Substance Registry System | 1,3,5-Benzenetriamine (108-72-5) |
| | 1,3,5-TRIAMINOBENZENE Usage And Synthesis |
| Chemical Properties | Solid. Soluble in water, acetone,
and alcohol; insoluble in ether, cold benzene,
carbon tetrachloride, and petroleum ether. Combustible. | | Uses | Ion-exchange resin intermediate, wetting and
frothing agents, photographic developers, organic
reactions. | | Definition | ChEBI: Benzene-1,3,5-triamine is a benzenetriamine. |
| | 1,3,5-TRIAMINOBENZENE Preparation Products And Raw materials |
| Raw materials | 3,5-DINITROANILINE-->1,3,5-Benzenetriamine, N1,N3,N5-trihydroxy--->1,3,5-trihydroxyamino-benzene-->3,5-Dibromoaniline-->5-CHLORO-M-PHENYLENEDIAMINE-->2,4,6-TRINITROBENZOIC ACID-->1,3,5-Tribromobenzene-->PICRIC ACID | | Preparation Products | 1,3,5-triisothiocyanatobenzene |
|