|
|
| | 2-HYDROXY-3-PHENOXYPROPYL ACRYLATE Basic information |
| | 2-HYDROXY-3-PHENOXYPROPYL ACRYLATE Chemical Properties |
| Boiling point | 380.9±32.0 °C(Predicted) | | density | 1.16 g/mL at 25 °C (lit.) | | vapor pressure | 0.004Pa at 25℃ | | refractive index | n20/D 1.528(lit.) | | Fp | 192 °F | | pka | 13.04±0.20(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Water Solubility | 5.3g/L at 20℃ | | InChI | InChI=1S/C12H14O4/c1-2-12(14)16-9-10(13)8-15-11-6-4-3-5-7-11/h2-7,10,13H,1,8-9H2 | | InChIKey | HHQAGBQXOWLTLL-UHFFFAOYSA-N | | SMILES | C(OCC(O)COC1=CC=CC=C1)(=O)C=C | | LogP | 2.03 at 25℃ | | EPA Substance Registry System | 3-Phenoxy-2-hydroxypropyl acrylate (16969-10-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2916.12.1000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2 Eye Dam. 1 Skin Sens. 1B |
| | 2-HYDROXY-3-PHENOXYPROPYL ACRYLATE Usage And Synthesis |
| Uses | Polymeric membranes for controlled drug release systems may be prepared by the photosynthesis of 2-hydroxy-3-phenoxypropyl acrylate by UV radiation. Tthe product can be used as a curing agent during the fabrication of poly (phenylene ether)-based substrate materials. |
| | 2-HYDROXY-3-PHENOXYPROPYL ACRYLATE Preparation Products And Raw materials |
|