|
|
| | 3-Chlorobenzoyl chloride Basic information |
| | 3-Chlorobenzoyl chloride Chemical Properties |
| Melting point | 6.85°C | | Boiling point | 225 °C (lit.) | | density | 1.367 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.569(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Chloroform, Hexanes | | form | Liquid | | color | Clear colorless | | Sensitive | Moisture Sensitive | | BRN | 386256 | | InChI | InChI=1S/C7H4Cl2O/c8-6-3-1-2-5(4-6)7(9)10/h1-4H | | InChIKey | WHIHIKVIWVIIER-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C1=CC=CC(Cl)=C1 | | CAS DataBase Reference | 618-46-2(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoyl chloride, 3-chloro-(618-46-2) | | EPA Substance Registry System | Benzoyl chloride, 3-chloro- (618-46-2) |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 26-36/37/39-45-28A | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 1 | | F | 19 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29163900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
STOT SE 3 |
| | 3-Chlorobenzoyl chloride Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Uses | 3-Chlorobenzoyl Chloride is used in the synthesis of isoquinoline derivatives as potent CRTH2 antagonists in treatment of allergies. Also used in the synthesis of anticancer 2-phenzainamine derivatives. |
| | 3-Chlorobenzoyl chloride Preparation Products And Raw materials |
|