| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:3-(Perfluorobutyryl)-(?)-caMphor
CAS:115224-00-5
Purity:98% Package:1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:3-(Perfluorobutyryl)-(-)-camphor
CAS:115224-00-5
Purity:98% Package:1G Remarks:298336-1G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:3-(Perfluorobutyryl)-()-camphor
CAS:115224-00-5
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Product Name:3-(Perfluorobutyryl)-()-camphor
CAS:115224-00-5
|
|
| | 3-(HEPTAFLUOROBUTYRYL)-I-CAMPHOR Basic information |
| Product Name: | 3-(HEPTAFLUOROBUTYRYL)-I-CAMPHOR | | Synonyms: | 3-HEPTAFLUOROBUTYRYL-(-)-CAMPHOR;3-(HEPTAFLUOROBUTYRYL)-I-CAMPHOR;3-(heptafluorobutyryl)-L-camphor;3-(Perfluorobutyryl)-(-)-camphor, 98%;3-(perfluorobutyryl)-l-camphor;3-(Heptafluorobutyryl)-L-camphor, 3-Heptafluorobutyryl-(-)-camphor;Bicyclo[2.2.1]heptan-2-one, 3-(2,2,3,3,4,4,4-heptafluoro-1-oxobutyl)-1,7,7-trimethyl-, (1S,4S)-;3-(PERFLUOROBUTYRYL)-I-CAMPHOR | | CAS: | 115224-00-5 | | MF: | C14H15F7O2 | | MW: | 348.26 | | EINECS: | | | Product Categories: | | | Mol File: | 115224-00-5.mol |  |
| | 3-(HEPTAFLUOROBUTYRYL)-I-CAMPHOR Chemical Properties |
| Boiling point | 266.9±0.0 °C(Predicted) | | density | 1.218 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.422(lit.) | | Fp | 201 °F | | pka | 7.94±0.60(Predicted) | | Optical Rotation | [α]19/D 123°, c = 2.6 in chloroform | | BRN | 2306496 | | InChI | 1S/C14H15F7O2/c1-10(2)6-4-5-11(10,3)8(22)7(6)9(23)12(15,16)13(17,18)14(19,20)21/h6-7H,4-5H2,1-3H3/t6-,7,11+/m0/s1 | | InChIKey | PEWOESYEGLBLNR-NSMOOJLNSA-N | | SMILES | CC1(C)C2CC[C@]1(C)C(=O)C2C(=O)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | (1S,4S)-3-(Heptafluorobutyryl)camphor (115224-00-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-(HEPTAFLUOROBUTYRYL)-I-CAMPHOR Usage And Synthesis |
| Uses | 3-(Perfluorobutyryl)-()-camphor can be used:
- To prepare mesoporous metal-organichybrid materials, which are used as catalysts in the asymmetric hetero-Diels-Alder cyclization of Danishefsky′s diene with benzaldehydes.
- As a precursor in the synthesis of chiral tetrakis(β-diketonate) Ln(III) complexes.
|
| | 3-(HEPTAFLUOROBUTYRYL)-I-CAMPHOR Preparation Products And Raw materials |
|