|
|
| | 2-(4-Cyanophenyl)-3'-trifluoromethylacetophenone Basic information |
| Product Name: | 2-(4-Cyanophenyl)-3'-trifluoromethylacetophenone | | Synonyms: | 1-(4-cyano)benzyl-1-(3-trifluoromethyl)phenylketone;5-(4-((1H-1,2,4-triazol-1-yl)methyl)phenyl)-1H-tetrazole;4-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]- benzonitrile;Metaflumizone Metabolite D Standard;Benzonitrile, 4-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]-;Metaflumizone ketone;2-(4-Cyanophenyl)-3'-trifluoromethylacetophenone | | CAS: | 146653-56-7 | | MF: | C16H10F3NO | | MW: | 289.25 | | EINECS: | | | Product Categories: | | | Mol File: | 146653-56-7.mol |  |
| | 2-(4-Cyanophenyl)-3'-trifluoromethylacetophenone Chemical Properties |
| Boiling point | 384.4±42.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | form | crystalline powder | | color | Pale lemon/gold | | InChI | 1S/C16H10F3NO/c17-16(18,19)14-3-1-2-13(9-14)15(21)8-11-4-6-12(10-20)7-5-11/h1-7,9H,8H2 | | InChIKey | CMHGFDOROXXOOB-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cccc(c1)C(=O)Cc2ccc(cc2)C#N | | EPA Substance Registry System | Benzonitrile, 4-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]- (146653-56-7) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-(4-Cyanophenyl)-3'-trifluoromethylacetophenone Usage And Synthesis |
| Uses | Metaflumizone(M225825) which is a semicarbazone insecticide that works by blocking sodium channel in target insects resulting in paralyzation associated with blocking nerve activity. Metaflumizone is useful as a heartworm control treatment. |
| | 2-(4-Cyanophenyl)-3'-trifluoromethylacetophenone Preparation Products And Raw materials |
|