| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:2-chloro-6,7-dimethoxy-4-methylquinoline(SALTDATA: FREE) CAS:697793-63-8 Purity:95% Package:50G, 1G, 5G, 10G, 25G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:2-Chloro-6,7-dimethoxy-4-methylquinoline CAS:697793-63-8
|
|
| | 2-CHLORO-6,7-DIMETHOXY-4-METHYLQUINOLINE Basic information |
| | 2-CHLORO-6,7-DIMETHOXY-4-METHYLQUINOLINE Chemical Properties |
| form | solid | | InChI | 1S/C12H12ClNO2/c1-7-4-12(13)14-9-6-11(16-3)10(15-2)5-8(7)9/h4-6H,1-3H3 | | InChIKey | JWSDOYINPAVDIM-UHFFFAOYSA-N | | SMILES | ClC1=NC(C(C(C)=C1)=C2)=CC(OC)=C2OC |
| Risk Statements | 36 | | Safety Statements | 26 | | RIDADR | UN 2811 6.1 / PGIII | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| | 2-CHLORO-6,7-DIMETHOXY-4-METHYLQUINOLINE Usage And Synthesis |
| | 2-CHLORO-6,7-DIMETHOXY-4-METHYLQUINOLINE Preparation Products And Raw materials |
|