|
|
| | 2,6-Dichloroquinoline-3-carbonitrile Basic information |
| | 2,6-Dichloroquinoline-3-carbonitrile Chemical Properties |
| Boiling point | 380.8±37.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | form | solid | | pka | -3.78±0.50(Predicted) | | InChI | 1S/C10H4Cl2N2/c11-8-1-2-9-6(4-8)3-7(5-13)10(12)14-9/h1-4H | | InChIKey | VITYMWFVJDUOBD-UHFFFAOYSA-N | | SMILES | Clc1ccc2nc(Cl)c(cc2c1)C#N |
| Hazard Codes | T | | Risk Statements | 25-41 | | Safety Statements | 26-39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
| | 2,6-Dichloroquinoline-3-carbonitrile Usage And Synthesis |
| | 2,6-Dichloroquinoline-3-carbonitrile Preparation Products And Raw materials |
|