|
|
| | 17ALPHA,20BETA-DIHYDROXY-4-PREGNEN-3-ONE Basic information |
| Product Name: | 17ALPHA,20BETA-DIHYDROXY-4-PREGNEN-3-ONE | | Synonyms: | (8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one;4-Pregnen-17α,20β-diol-3-one;Maturation-inducing HorMone;Maturation Inducing hormone (MIF);17-alfa,20-beta-Dihydroxy Progesterone;Progesterone Impurity 18;17alpha,20beta-dihydroxypregn-4-en-3-one;MIS (SALMONID) | | CAS: | 1662-06-2 | | MF: | C21H32O3 | | MW: | 332.48 | | EINECS: | | | Product Categories: | Steroids | | Mol File: | 1662-06-2.mol |  |
| | 17ALPHA,20BETA-DIHYDROXY-4-PREGNEN-3-ONE Chemical Properties |
| Melting point | 201-202°C | | Boiling point | 487.1±45.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Acetone (Slightly), Methanol (Slightly), DMSO | | pka | 14.79±0.60(Predicted) | | form | crystalline | | color | White to Pale Yellow | | biological source | synthetic (organic) | | Stability: | Store in Freezer | | InChIKey | MASCESDECGBIBB-FSHQYNQFSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@](O)([C@H](O)C)CC3)CC2 | | EPA Substance Registry System | (20R)-17,20-Dihydroxypregn-4-en-3-one (1662-06-2) |
| | 17ALPHA,20BETA-DIHYDROXY-4-PREGNEN-3-ONE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 4-Pregnen-17α,20β-diol-3-one (cas# 1662-06-2) is a derivative of 17α-Hydroxy Progesterone (H952330), which is a metabolite of Progesterone (P755900). It can also be used as an antagonist of cb1 receptor for therapeutic use. | | Definition | ChEBI: (20R)-17,20-dihydroxypregn-4-en-3-one is a 17,20-dihydroxypregn-4-en-3-one. | | Biochem/physiol Actions | 17α,20β-Dihydroxy-4-pregnen-3-one, also known as maturation-inducing hormone (MIH) or DHP, is the most potent steroid for inducing final oocyte maturation in several species of fish. DHP as a progestin regulates spermiation, improves sperm motility and acts as a pheromone in male cyprinids. |
| | 17ALPHA,20BETA-DIHYDROXY-4-PREGNEN-3-ONE Preparation Products And Raw materials |
|