6-Chloro-3-(tributylstannyl)pyridine manufacturers
|
| | 6-Chloro-3-(tributylstannyl)pyridine Basic information |
| Product Name: | 6-Chloro-3-(tributylstannyl)pyridine | | Synonyms: | 6-Chloro-3-(tributylstannyl)pyridine;2-Chloro-5-(tributylstannyl)pyridine;Pyridine, 2-chloro-5-(tributylstannyl)-;SKL1084;Tributyl-(6-chloropyridin-3-yl)stannane;6-Chloro-3-(tributylstannyl)pyridine - [C3121] | | CAS: | 183545-05-3 | | MF: | C17H30ClNSn | | MW: | 402.59 | | EINECS: | | | Product Categories: | Stannanes | | Mol File: | 183545-05-3.mol |  |
| | 6-Chloro-3-(tributylstannyl)pyridine Chemical Properties |
| Boiling point | 399.9±52.0 °C(Predicted) | | storage temp. | Storage temp. -20°C | | pka | 0.12±0.10(Predicted) | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C5H3ClN.3C4H9.Sn/c6-5-3-1-2-4-7-5;3*1-3-4-2;/h1,3-4H;3*1,3-4H2,2H3; | | InChIKey | HYTTVKRGUYTJLN-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(Cl)nc1 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | 6-Chloro-3-(tributylstannyl)pyridine Usage And Synthesis |
| | 6-Chloro-3-(tributylstannyl)pyridine Preparation Products And Raw materials |
|