| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-(Diphenylphosphino)propionic acid Basic information |
| Product Name: | 3-(Diphenylphosphino)propionic acid | | Synonyms: | 3-(Diphenylphosphino)propionic acid;3-(Diphenylphosphino)propionic acid 97%;(2-Carboxyethyl)diphenylphosphine;4,4-Diphenyl-4-phosphabutanoic acid;3-(diphenylphosphino)-Propanoic acid;Propanoic acid, 3-(diphenylphosphino)-;3-(diphenylphosphanyl)propanoic acid;3- (diphenylphosphine) propionic acid | | CAS: | 2848-01-3 | | MF: | C15H15O2P | | MW: | 258.25 | | EINECS: | | | Product Categories: | | | Mol File: | 2848-01-3.mol |  |
| | 3-(Diphenylphosphino)propionic acid Chemical Properties |
| Melting point | 130-134°C | | Boiling point | 151 °C(Press: 0.4 Torr) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 4.50±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C15H15O2P/c16-15(17)11-12-18(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,16,17) | | InChIKey | OTSIFUHGOBFOTH-UHFFFAOYSA-N | | SMILES | OC(=O)CCP(c1ccccc1)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-(Diphenylphosphino)propionic acid Usage And Synthesis |
| Uses | Reactant for:
- Organocatalytic asymmetric aziridination of imines and diazo compounds
- Phosphine-mediated conversion of azides into diazo compounds
- Preparation of rhodium catalysts for hydroformylation
- Synthesis of reagents for the Mitsunobu reaction
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | 3-(Diphenylphosphino)propionic acid Preparation Products And Raw materials |
|