3-Hydroxycyclobutanecarboxylic acid manufacturers
|
| | 3-Hydroxycyclobutanecarboxylic acid Basic information |
| Product Name: | 3-Hydroxycyclobutanecarboxylic acid | | Synonyms: | Cyclobutanecarboxylic acid, 3-hydroxy-, trans-;(1R,3R)-3-hydroxycyclobutanecarboxylic acid;rac-(1r,3r)-3-hydroxycyclobutane-1-carboxylic acid, trans;3-HYDROXYCYCLOBUTANECARBOXYLIC ACID;trans-3-Hydroxycyclobutanecarboxylic acid - [H14950];rel-(1r,3r)-3-hydroxycyclobutane-1-carboxylic acid;(1r,3r)-3-hydroxycyclobutane-1-carboxylic acid;trans-3-Hydroxycyclobutanecarboxylic acid | | CAS: | 1268521-85-2 | | MF: | C5H8O3 | | MW: | 116.12 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 1268521-85-2.mol |  |
| | 3-Hydroxycyclobutanecarboxylic acid Chemical Properties |
| Boiling point | 290.129±33.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.448±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | pka | 4.537±0.40(predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H8O3/c6-4-1-3(2-4)5(7)8/h3-4,6H,1-2H2,(H,7,8)/t3-,4- | | InChIKey | ZSHGVMYLGGANKU-JPYJGEKTSA-N | | SMILES | [C@@H]1(C(O)=O)C[C@@H](O)C1 |
| HS Code | 2916200090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-Hydroxycyclobutanecarboxylic acid Usage And Synthesis |
| Uses | 3-Hydroxycyclobutanecarboxylic acid is used for synthesis API and research. |
| | 3-Hydroxycyclobutanecarboxylic acid Preparation Products And Raw materials |
|