| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Cobalt(II) benzoylacetonate Basic information |
| | Cobalt(II) benzoylacetonate Chemical Properties |
| Melting point | 125 °C (dec.)(lit.) | | form | powder | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/2C10H10O2.Co/c2*1-8(11)7-10(12)9-5-3-2-4-6-9;/h2*2-7,11H,1H3;/q;;+2/p-2/b2*8-7+; | | InChIKey | JEMVMUWUMZLULL-ORWWTJHYSA-L | | SMILES | C\C(O[Co]O\C(C)=C\C(=O)c1ccccc1)=C/C(=O)c2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Cobalt(II) benzoylacetonate Usage And Synthesis |
| | Cobalt(II) benzoylacetonate Preparation Products And Raw materials |
|