| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Cibenzoline succinate Basic information |
| Product Name: | Cibenzoline succinate | | Synonyms: | (+-)-2-(2,2-diphenylcyclopropyl)-2-imidazolinesuccinate(1:1);ole(1:1);ritmalan;ro22-7796/001;succinic acid, compound with 2-(2,2-diphenylcyclopropyl)-4,5-dihydro-1H-imidazole (1:2);2-(2,2-Diphenylcyclopropyl)-4,5-dihydro-1H-imidazole succinate;2-(2,2-diphenylcyclopropyl)-4,5-dihydro-1H-imidazole succinate, Cibenol, Cipralan, Exacor;Cinobezile | | CAS: | 100678-32-8 | | MF: | C18H18N2.C4H6O4 | | MW: | 380.44 | | EINECS: | 634-471-4 | | Product Categories: | Heterocyclic Compounds | | Mol File: | 100678-32-8.mol |  |
| | Cibenzoline succinate Chemical Properties |
| Melting point | 165° | | storage temp. | 2-8°C | | solubility | H2O: ≥5mg/mL | | form | solid | | color | white to off-white | | Water Solubility | H2O: ≥5mg/mL | | Stability: | Light Sensitive | | InChI | 1S/C18H18N2.C4H6O4/c1-3-7-14(8-4-1)18(15-9-5-2-6-10-15)13-16(18)17-19-11-12-20-17;5-3(6)1-2-4(7)8/h1-10,16H,11-13H2,(H,19,20);1-2H2,(H,5,6)(H,7,8) | | InChIKey | XFUIOIWYMHEPIE-UHFFFAOYSA-N | | SMILES | OC(=O)CCC(O)=O.C1CN=C(N1)C2CC2(c3ccccc3)c4ccccc4 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | EJ9960100 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Cibenzoline succinate Usage And Synthesis |
| Uses | Cardiac
depressant (anti-arrhythmic). | | Uses | Cibenzoline Succinate acts as a highly active class I antiarrhythmic agent. | | Definition | ChEBI: Cibenzoline succinate is a diarylmethane. | | General Description | Cibenzoline also called (±)-2-(2,2-diphenylcyclopropyl)-2-imidazoline succinate, is generally used in stereo combination of R(+) and S() forms. It also exhibits anticholinergic activity.. Cibenzoline is known to improve left ventricular diastolic dysfunction by reducing left ventricular pressure gradient. | | Biochem/physiol Actions | Cibenzoline is a class IA antiarrhythmic drug. Cibenzoline (μM concentrations) blocks ATP-sensitive K channels in heart and pancreatic cells. Cibenzoline interacts with the channel pore-forming subunit of the K(ATP) channel (Kir6.2) from the cytoplasmic side. Cibenzoline also inhibits the delayed rectifier K current [I(Kr)] in sino-atrial node cells. |
| | Cibenzoline succinate Preparation Products And Raw materials |
|