Cyclopentanol, 3-amino-, hydrochloride (1:1) manufacturers
|
| | Cyclopentanol, 3-amino-, hydrochloride (1:1) Basic information |
| Product Name: | Cyclopentanol, 3-amino-, hydrochloride (1:1) | | Synonyms: | 3-AMinocyclopentanol, HCl;3-aminocyclopentan-1-ol hydrochloride;3-AMinocyclopentanol hdydrochloride;3-AMinocyclopentanol hydr...;Cyclopentanol, 3-amino-, hydrochloride (1:1);3-amino-Cyclopentanol hydrochloride (1:1);3-Aminocyclopentanol hydrochloride (cis-trans mixture);3-AMINO-CYCLOPENTANOL hyd... | | CAS: | 1184919-69-4 | | MF: | C5H12ClNO | | MW: | 137.61 | | EINECS: | | | Product Categories: | | | Mol File: | 1184919-69-4.mol |  |
| | Cyclopentanol, 3-amino-, hydrochloride (1:1) Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | Colorless to off-white Solid-Liquid Mixture | | InChI | InChI=1S/C5H11NO.ClH/c6-4-1-2-5(7)3-4;/h4-5,7H,1-3,6H2;1H | | InChIKey | SGKRJNWIEGYWGE-UHFFFAOYSA-N | | SMILES | NC1CCC(O)C1.Cl |
| | Cyclopentanol, 3-amino-, hydrochloride (1:1) Usage And Synthesis |
| Uses | 3-Aminocyclopentanol Hydrochloride is used in preparation of oxo-pyridine fusion ring derivatives as RON inhibitors for treatment of RON-related diseases. | | Synthesis | General procedure for the synthesis of 3-aminocyclopentanol hydrochloride from the compound (CAS: 1445796-28-0): concentrated hydrochloric acid (HCl, 10 mL) was slowly added to a solution of compound 4 (8.0 g, 34 mmol) in methanol (MeOH, 100 mL), and the reaction mixture was subsequently heated and refluxed for 2 hours. Upon completion of the reaction, the mixture was concentrated under reduced pressure to remove the solvent. The obtained residue was dissolved in water and washed with ethyl acetate (EA). The aqueous phase was subsequently concentrated under reduced pressure to afford the target product 3-aminocyclopentanol hydrochloride (2.8 g, 82% yield) containing the HCl salt. The structure of the product was confirmed by 1H NMR (400 MHz, CDCl3) with the following chemical shifts (δ ppm): 4.33 (broad single peak, 1H), 3.66 (broad single peak, 1H), 2.08-2.16 (multiple peaks, 2H), 1.74-1.90 (multiple peaks, 4H). | | References | [1] Patent: WO2013/96744, 2013, A1. Location in patent: Page/Page column 215 |
| | Cyclopentanol, 3-amino-, hydrochloride (1:1) Preparation Products And Raw materials |
|