|
|
| | Piperidine-4-boronic acid pinacol ester HCl Basic information |
| Product Name: | Piperidine-4-boronic acid pinacol ester HCl | | Synonyms: | Piperidine-4-boronic acid picol ester hydrochloride;Piperidine-4-boronic acid pinacol ester HCl;Piperidine-4-boronic acid pinacol ester hydrochloride;4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine hydrochloride;Piperidine-4-boronic acid pinacol ester hydrochloride 95%;Piperidine, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, hydrochloride (1:1);4-(tetramethyl-1,3,2-dioxapentane-2-yl)piperidine HCl;piperidine-4-boronic acid pinacol ester HCl - [P81770] | | CAS: | 1218790-99-8 | | MF: | C11H23BClNO2 | | MW: | 247.57 | | EINECS: | | | Product Categories: | | | Mol File: | 1218790-99-8.mol |  |
| | Piperidine-4-boronic acid pinacol ester HCl Chemical Properties |
| Melting point | 188-192°C | | storage temp. | 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C11H22BNO2.ClH/c1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9;/h9,13H,5-8H2,1-4H3;1H | | InChIKey | DJEBJGUAIJWKGA-UHFFFAOYSA-N | | SMILES | Cl.CC1(C)OB(OC1(C)C)C2CCNCC2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Piperidine-4-boronic acid pinacol ester HCl Usage And Synthesis |
| | Piperidine-4-boronic acid pinacol ester HCl Preparation Products And Raw materials |
|