| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | (R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate Basic information |
| Product Name: | (R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate | | Synonyms: | Rivastigmine Related Compound B (15 mg) ((R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate);3-(1-(diMethylaMino)ethyl)phenyl diMethylcarbaMate;RivastigMine USP RC B;(RS)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate;N-Dimethyl Rivastigmine (Rivastigmine EP Impurity B);Rivastigmine EP Impurity B;N,N-Dimethylcarbamic acid 3-[(RS)-1-(dimethyl amino) ethyl]phenyl ester;Desmethyl Rivastigmine | | CAS: | 25081-93-0 | | MF: | C13H20N2O2 | | MW: | 236.31 | | EINECS: | | | Product Categories: | | | Mol File: | 25081-93-0.mol | ![(R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate Structure](CAS/GIF/25081-93-0.gif) |
| | (R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate Chemical Properties |
| Boiling point | 299.4±32.0 °C(Predicted) | | density | 1.051±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 8.58±0.50(Predicted) | | form | liquid | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C13H20N2O2/c1-10(14(2)3)11-7-6-8-12(9-11)17-13(16)15(4)5/h6-10H,1-5H3 | | InChIKey | AIHREYCBCYOMLZ-UHFFFAOYSA-N | | SMILES | N(C(C)c1cc(ccc1)OC(=O)N(C)C)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2924296000 | | Storage Class | 11 - Combustible Solids |
| | (R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate Usage And Synthesis |
| Uses | (R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate is an impurity of Rivastigmine (R541000), a brain selective acetylcholinesterase inhibitor used as a nootropic agent. | | Uses | N-Desethyl N-Methyl rac-Rivastigmine (Rivastigmin USP Related Compound B) is an impurity in the synthesis of Rivastigmine (R541000) a brain selective acetylcholinesterase inhibitor. Nootropic. |
| | (R,S)-3-[1-(Dimethylamino)ethyl]phenyl dimethylcarbamate Preparation Products And Raw materials |
|