| Company Name: |
Qingdao Tenglong microwave technology co., LTD.
|
| Tel: |
0532-83818797 18561885118 |
| Email: |
market@tlwb.com.cn |
| Products Intro: |
Product Name:TRIETHYLPHOSPHONOACETATE (1-13C, 99%) CAS:61203-67-6 Purity:98% Package:1G Remarks:CLM-1143-1
|
| Company Name: |
Reer Technology (Shanghai) Co., LTD
|
| Tel: |
021-64400900 15800436310 |
| Email: |
bessey@reertech.com |
| Products Intro: |
Product Name:TRIETHYLPHOSPHONOACETATE(1-13C, 99%) CAS:61203-67-6 Purity:98% Package:1 G Remarks:CLM-1143-1
|
| Company Name: |
CHINA ISOTOPE CO., LIMITED
|
| Tel: |
02151600108 13062666369 |
| Email: |
info@isotopechem.com |
| Products Intro: |
Product Name:TRIETHYLPHOSPHONOACETATE (1-13C, 99%) CAS:61203-67-6 Purity:98% Package:1 G Remarks:CLM-1143-1
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Triethyl phosphonoacetate-1-13C CAS:61203-67-6
|
|
| | TRIETHYL PHOSPHONOACETATE-1-13C Basic information |
| | TRIETHYL PHOSPHONOACETATE-1-13C Chemical Properties |
| Boiling point | 142-145 °C9 mm Hg(lit.) | | density | 1.13 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.431(lit.) | | Fp | >230 °F | | InChI | 1S/C8H17O5P/c1-4-11-8(9)7-14(10,12-5-2)13-6-3/h4-7H2,1-3H3/i8+1 | | InChIKey | GGUBFICZYGKNTD-VJJZLTLGSA-N | | SMILES | CCO[13C](=O)CP(=O)(OCC)OCC | | CAS Number Unlabeled | 867-13-0 |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/22 | | Safety Statements | 26-36-60-23-9 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 |
| | TRIETHYL PHOSPHONOACETATE-1-13C Usage And Synthesis |
| reaction suitability | reaction type: C-C Bond Formation reaction type: Olefinations |
| | TRIETHYL PHOSPHONOACETATE-1-13C Preparation Products And Raw materials |
|