|
|
| | ethyl 5-broMo-6-hydroxynicotinate Basic information |
| Product Name: | ethyl 5-broMo-6-hydroxynicotinate | | Synonyms: | 5-Bromo-6-hydroxy-nicotinic acid ethyl ester;ethyl 5-broMo-6-hydroxynicotinate;3-Pyridinecarboxylic acid, 5-broMo-1,6-dihydro-6-oxo-, ethyl ester;ethyl 5-bromo-6-oxo-1H-pyridine-3-carboxylate;ethyl 5-bromo-6-oxo-1,6-dihydropyridine-3-carboxylate;5-bromo-6-hydroxyacidethyl ester | | CAS: | 169773-94-8 | | MF: | C8H8BrNO3 | | MW: | 246.06 | | EINECS: | | | Product Categories: | | | Mol File: | 169773-94-8.mol |  |
| | ethyl 5-broMo-6-hydroxynicotinate Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | Off-white | | InChI | InChI=1S/C8H8BrNO3/c1-2-13-8(12)5-3-6(9)7(11)10-4-5/h3-4H,2H2,1H3,(H,10,11) | | InChIKey | NTQHDRQVVANNHZ-UHFFFAOYSA-N | | SMILES | C1NC(=O)C(Br)=CC=1C(OCC)=O |
| | ethyl 5-broMo-6-hydroxynicotinate Usage And Synthesis |
| | ethyl 5-broMo-6-hydroxynicotinate Preparation Products And Raw materials |
|