- HEXADECANAMIDE
-
- $10.00 / 1KG
-
2026-01-05
- CAS:629-54-9
- Min. Order: 100KG
- Purity: 99%
- Supply Ability: 100 mt
- HEXADECANAMIDE
-
- $100.00 / 1kg
-
2025-04-15
- CAS:629-54-9
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 5000
|
| | HEXADECANAMIDE Basic information |
| | HEXADECANAMIDE Chemical Properties |
| Melting point | 106°C | | Boiling point | 236 °C / 12mmHg | | density | 1.0000 | | refractive index | 1.4545 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 16.61±0.40(Predicted) | | form | Solid | | color | White to Off-White | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C16H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H2,17,18) | | InChIKey | HSEMFIZWXHQJAE-UHFFFAOYSA-N | | SMILES | C(N)(=O)CCCCCCCCCCCCCCC | | LogP | 6.200 (est) | | EPA Substance Registry System | Hexadecanamide (629-54-9) |
| TSCA | TSCA listed | | HS Code | 2924297099 |
| | HEXADECANAMIDE Usage And Synthesis |
| Uses | Hexadecanamide can be used to prepare tissue regeneration. | | Definition | ChEBI: A fatty amide that is the carboxamide derived from palmitic acid. | | Safety Profile | When heated to decomposition it emits acrid smoke and irritating fumes | | IC 50 | PPARα | | Purification Methods | Crystallise the amide from thiophene-free *benzene and dry it under vacuum over P2O5. It is slightly soluble in EtOH, Me2CO, CHCl3 and toluene but insoluble in H2O. [Beilstein 2 H 374, 2 II 341, 2 III 975, 2 IV 1182.] |
| | HEXADECANAMIDE Preparation Products And Raw materials |
|