|
|
| | trans-4-Morpholinocyclohexanol Basic information |
| Product Name: | trans-4-Morpholinocyclohexanol | | Synonyms: | trans-4-Morpholinocyclohexanol;trans-4-(4-Morpholinyl)cyclohexanol;trans-4-Morpholin-4-yl-cyclohexanol;EOS-60732;trans-(1r,4r)-4-Morpholinocyclohexan-1-ol;trans-4-(morpholin-4-yl)cyclohexan-1-ol;(1r,4r)-4-morpholinocyclohexanol;quinolin-2-ylcarbonyl chloride | | CAS: | 1228947-14-5 | | MF: | C10H19NO2 | | MW: | 185.26 | | EINECS: | | | Product Categories: | | | Mol File: | 1228947-14-5.mol |  |
| | trans-4-Morpholinocyclohexanol Chemical Properties |
| Melting point | 113-114 °C | | Boiling point | 292.192±35.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.118±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 15.183±0.40(predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H19NO2/c12-10-3-1-9(2-4-10)11-5-7-13-8-6-11/h9-10,12H,1-8H2/t9-,10- | | InChIKey | AIFIVCWONKRRJQ-MGCOHNPYSA-N | | SMILES | [C@@H]1(O)CC[C@@H](N2CCOCC2)CC1 |
| | trans-4-Morpholinocyclohexanol Usage And Synthesis |
| Uses | trans-4-Morpholinocyclohexanol is a reagent used in the preparation of quinazoline and quinoline derivatives which act as interleukin-1 receptor-associated kinases (IRAK) inhibitors. |
| | trans-4-Morpholinocyclohexanol Preparation Products And Raw materials |
|