| Company Name: |
Roshel Laboratories
|
| Tel: |
+91-8310388232 +91-9964951765 |
| Email: |
sheelaramesh@roshellaboratories.com |
| Products Intro: |
Product Name:benzyl (3aR,6aS)-5-oxo-octahydrocyclopenta[c]pyrrole-2-carboxylate
CAS:1217315-21-3
Purity:>97% Package:1g, 5g, 10g, 25g, 50g, 100g, 500g, 1 kg, 5 kg, 10 kg, 25kg, 50kg, 100 kg, 500 kg and 1 MT
|
|
| | (3aR,6aS)-benzyl 5-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate Basic information |
| Product Name: | (3aR,6aS)-benzyl 5-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate | | Synonyms: | (3aR,6aS)-benzyl 5-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate;Cyclopenta[c]pyrrole-2(1H)-carboxylic acid, hexahydro-5-oxo-, phenylmethyl ester, (3aR,6aS)-rel-;(3aR,6aS)-benzyl 5-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate ISO 9001：2015 REACH;benzyl
(3aR,6aS)-5-oxo-octahydrocyclopenta[c]pyrrole-2-
carboxylate;rel-Benzyl (3aR,6aS)-5-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate | | CAS: | 1217315-21-3 | | MF: | C15H17NO3 | | MW: | 259.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1217315-21-3.mol | ![(3aR,6aS)-benzyl 5-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate Structure](CAS/20150408/GIF/1217315-21-3.gif) |
| | (3aR,6aS)-benzyl 5-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate Chemical Properties |
| Boiling point | 415.7±45.0 °C(Predicted) | | density | 1.241±0.06 g/cm3(Predicted) | | pka | -0.87±0.20(Predicted) | | InChI | InChI=1/C15H17NO3/c17-14-6-12-8-16(9-13(12)7-14)15(18)19-10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2/t12-,13+ | | InChIKey | UKDGMCVWUBALEW-BETUJISGNA-N | | SMILES | N1(C(OCC2=CC=CC=C2)=O)C[C@]2([H])CC(=O)C[C@]2([H])C1 |&1:12,18,r| |
| | (3aR,6aS)-benzyl 5-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate Usage And Synthesis |
| | (3aR,6aS)-benzyl 5-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate Preparation Products And Raw materials |
|