| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(-)-Trger's base
CAS:14645-24-0
Purity:for chiral derivatization, >=99.0% Package:100MG Remarks:40765-100MG
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:()-Trger′s base
CAS:14645-24-0
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:(–)-Tröger′s base, CAS 14645-24-0
CAS:14645-24-0
|
| Company Name: |
Absin Bioscience Inc.
|
| Tel: |
021-38015121-8802 |
| Email: |
chenjw@absin.cn |
| Products Intro: |
Product Name:(–)-Tröger's base
CAS:14645-24-0
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Product Name:()-Trger’s base
CAS:14645-24-0
|
|
| | (-)-TROGER'S BASE Basic information |
| Product Name: | (-)-TROGER'S BASE | | Synonyms: | (5S,11S)-(-)-2,8-DIMETHYL-6H,12H-5,11-METHANODIBENZO[B,F][1,5]DIAZOCIN;(-)-TROGER'S BASE;(S)-2,8-dimethyl-5,11-methanodibenzo (B,F)(1,5)diazocin;(-)-TRGER'S BASE;6H,12H-5,11-Methanodibenzo[b,f][1,5]diazocine, 2,8-dimethyl-, (5R,11R)-;(?)-Tr?ger′s base;(–)-Tr?ger′s base, CAS 14645-24-0 | | CAS: | 14645-24-0 | | MF: | C17H18N2 | | MW: | 250.34 | | EINECS: | | | Product Categories: | | | Mol File: | 14645-24-0.mol |  |
| | (-)-TROGER'S BASE Chemical Properties |
| Melting point | 127-131 °C | | Boiling point | 461.0±45.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | pka | 4.53±0.20(Predicted) | | Optical Rotation | [α]20/D 283±4°, c = 0.3% in hexane | | BRN | 88611 | | InChI | 1S/C17H18N2/c1-12-3-5-16-14(7-12)9-18-11-19(16)10-15-8-13(2)4-6-17(15)18/h3-8H,9-11H2,1-2H3 | | InChIKey | SXPSZIHEWFTLEQ-UHFFFAOYSA-N | | SMILES | Cc1ccc2[N@@H]3C[N@H](Cc2c1)c4ccc(C)cc4C3 |
| | (-)-TROGER'S BASE Usage And Synthesis |
| Uses | It was used as an standard analyte for testing the enantioseparation capability of the chiral stationary phase column; in a study to understand the covalently bonded cellulose tris(3,5-dimethylphenylcarbamate) on a silica monolithic capillary column. | | General Description | Trger base (TB) is a chiral heterocyclic amine with chirality due to the presence of two stereogenic nitrogen atoms. |
| | (-)-TROGER'S BASE Preparation Products And Raw materials |
|