| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 1-Oxa-6-azaspiro[3.5]nonane oxalate(2:1) Basic information |
| | 1-Oxa-6-azaspiro[3.5]nonane oxalate(2:1) Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/2C7H13NO.C2H2O4/c2*1-2-7(3-5-9-7)6-8-4-1;3-1(4)2(5)6/h2*8H,1-6H2;(H,3,4)(H,5,6) | | InChIKey | BKJYYZARMVJURT-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(O)=O.C12(CCCNC1)CCO2.C12(CCCNC1)CCO2 |
| | 1-Oxa-6-azaspiro[3.5]nonane oxalate(2:1) Usage And Synthesis |
| Hazard |
1-Oxa-6-azaspiro[3.5]nonane oxalate(2:1) causes skin irritation and serious eye irritation.
|
| | 1-Oxa-6-azaspiro[3.5]nonane oxalate(2:1) Preparation Products And Raw materials |
|