| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Loxapine N-Oxide Basic information |
| Product Name: | Loxapine N-Oxide | | Synonyms: | Loxapine N-Oxide;8-chloro-6-(4-methyl-4-oxidopiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepine;Dibenz[b,f][1,4]oxazepine, 2-chloro-11-(4-methyl-4-oxido-1-piperazinyl)-;Loxapine N-OxideQ: What is
Loxapine N-Oxide Q: What is the CAS Number of
Loxapine N-Oxide Q: What is the storage condition of
Loxapine N-Oxide;Loxapine N-Oxide (25 mg) (4-(2-Chlorodibenzo[b,f][1,4]oxazepin-11-yl)-1-methylpiperazine 1-oxide);Loxapine N-oxide | | CAS: | 25967-34-4 | | MF: | C18H18ClN3O2 | | MW: | 343.81 | | EINECS: | | | Product Categories: | Metabolites & Impurities, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 25967-34-4.mol |  |
| | Loxapine N-Oxide Chemical Properties |
| storage temp. | -20°C | | solubility | DMSO (Very Slightly), Methanol (Slightly) | | pka | 4.98±0.20(Predicted) | | form | Solid | | color | White to Beige | | Stability: | Hygroscopic, Light Sensitive | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C18H18ClN3O2/c1-22(23)10-8-21(9-11-22)18-14-12-13(19)6-7-16(14)24-17-5-3-2-4-15(17)20-18/h2-7,12H,8-11H2,1H3 | | InChIKey | QUSWANHLDLADDR-UHFFFAOYSA-N | | SMILES | Clc1cc2c([o]c3c(nc2N4CC[N+](CC4)([O-])C)cccc3)cc1 |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | Loxapine N-Oxide Usage And Synthesis |
| Uses | Loxapine N-Oxide is a metabolite of Loxapine (L472750), a D2/D4-Dopamine receptor antagonist. It is a serotonergic receptor antagonist that acts as a dibenzoxazepine antipsychotic agent. |
| | Loxapine N-Oxide Preparation Products And Raw materials |
|