|
|
| | Pyridine-4-carboxylic acid N-oxide Basic information |
| | Pyridine-4-carboxylic acid N-oxide Chemical Properties |
| Melting point | 270-271 °C(lit.) | | Boiling point | 255.04°C (rough estimate) | | density | 1.4429 (rough estimate) | | refractive index | 1.5423 (estimate) | | storage temp. | 2-8°C | | pka | 3.66±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light red | | BRN | 119571 | | InChI | InChI=1S/C6H5NO3/c8-6(9)5-1-3-7(10)4-2-5/h1-4H,(H,8,9) | | InChIKey | QCWTWMJMLSKQCJ-UHFFFAOYSA-N | | SMILES | C1[N+]([O-])=CC=C(C(O)=O)C=1 | | LogP | -1.520 (est) | | CAS DataBase Reference | 13602-12-5(CAS DataBase Reference) | | EPA Substance Registry System | 4-Pyridinecarboxylic acid 1-oxide (13602-12-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Pyridine-4-carboxylic acid N-oxide Usage And Synthesis |
| Chemical Properties | white to beige or yellow crystalline powder | | Uses | Isonicotinic acid N-oxide was used in the synthesis of three-dimensional coordination polymers based on inorganic lanthanide(II) sulfate skeletons. | | Definition | ChEBI: Isonicotinic acid N-oxide is a member of pyridines and an aromatic carboxylic acid. | | General Description | Isonicotinic acid N-oxide interacts with 3d metal(II) perchlorates in ethanol-triethyl orthoformate leading to partial substitution of perchlorate with isonicotinate-N-oxide anionic groups. It reacts with AgClO4 or AgBF4 to yield distinct crystalline products. It forms polymeric lanthanide(III) complexes. |
| | Pyridine-4-carboxylic acid N-oxide Preparation Products And Raw materials |
|