| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-Chlorobicyclo[3.2.1]oct-2-ene Basic information |
| Product Name: | 3-Chlorobicyclo[3.2.1]oct-2-ene | | Synonyms: | 3-chlorobicyclo(3.2.1)oct-2-ene,mixtureof;3-Chlorobicyclo[3.2.1]oct-2-ene,mixture of endo and exo;3-CHLOROBICYCLO(3.2.1)OCT-2-ENE, 98%, MI XTURE OF ENDO AND EXO;3-Chlorobicyclo[3.2.1]oct-2-ene, mixture of endo and exo 98%;3-chlorobicyclo[3.2.1]oct-3-ene;Bicyclo[3.2.1]oct-2-ene, 3-chloro-;3-Chlorobicyclo[3.2.1]oct-2-ene, mixture of endo and exo;3-Chlorobicyclo[3.2.1]oct-2-ene | | CAS: | 35242-17-2 | | MF: | C8H11Cl | | MW: | 142.63 | | EINECS: | | | Product Categories: | Alkenyl;Halogenated Hydrocarbons;Organic Building Blocks | | Mol File: | 35242-17-2.mol | ![3-Chlorobicyclo[3.2.1]oct-2-ene Structure](CAS/GIF/35242-17-2.gif) |
| | 3-Chlorobicyclo[3.2.1]oct-2-ene Chemical Properties |
| Boiling point | 56 °C10 mm Hg(lit.) | | density | 1.082 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5055(lit.) | | Fp | 138 °F | | form | liquid | | InChI | 1S/C8H11Cl/c9-8-4-6-1-2-7(3-6)5-8/h4,6-7H,1-3,5H2/t6-,7+/m0/s1 | | InChIKey | XLVAWKKCOIWHBT-NKWVEPMBSA-N | | SMILES | ClC1=C[C@H]2CC[C@H](C2)C1 | | EPA Substance Registry System | 3-Chlorobicyclo[3.2.1]oct-2-ene (35242-17-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 3-Chlorobicyclo[3.2.1]oct-2-ene Usage And Synthesis |
| Uses | 3-Chlorobicyclo[3.2.1]oct-2-ene has been used in the preparation of bicyclo[3.2.1]oct-2-ene by Birch reduction. |
| | 3-Chlorobicyclo[3.2.1]oct-2-ene Preparation Products And Raw materials |
|