p-Nitrophenyl sulfate potassium salt manufacturers
|
| | p-Nitrophenyl sulfate potassium salt Basic information |
| | p-Nitrophenyl sulfate potassium salt Chemical Properties |
| Melting point | 246-250 °C(lit.) | | storage temp. | -20°C | | solubility | Water (Slightly) | | form | Crystalline Powder | | color | Pale yellow to yellow | | Water Solubility | water: 50mg/mL, clear, colorless to very faintly greenish-yellow (to Very Light Yellow) | | BRN | 3786392 | | InChI | InChI=1S/C6H5NO6S.K/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12;/h1-4H,(H,10,11,12);/q;+1/p-1 | | InChIKey | BITVAZYUWRLLCN-UHFFFAOYSA-M | | SMILES | S([O-])(=O)(=O)OC1C=CC([N+]([O-])=O)=CC=1.[K+] | | CAS DataBase Reference | 6217-68-1(CAS DataBase Reference) | | EPA Substance Registry System | Sulfuric acid, mono(4-nitrophenyl) ester, potassium salt (6217-68-1) |
| | p-Nitrophenyl sulfate potassium salt Usage And Synthesis |
| Chemical Properties | Yellowish Cyrstalline Solid | | Uses | Potassium p-Nitrophenyl Sulphate (cas# 6217-68-1) is a compound useful in organic synthesis. | | Uses | Potassium 4-nitrophenyl sulfate has been used:
- as a substrate to measure arylsulfatase activity in cell-free coelomic fluid
- as a substrate for p-nitrophenyl glycoside-based enzyme assay
- to inhibit arylsulfatase
- as an inorganic analog of organic aryl ester sulphate
|
| | p-Nitrophenyl sulfate potassium salt Preparation Products And Raw materials |
|