| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
Glycidyl PalMitoleate manufacturers
- UCM710
-
- $1980.00
-
2026-05-11
- CAS:213738-77-3
- Purity:
- Supply Ability: 10g
|
| | Glycidyl PalMitoleate Basic information |
| | Glycidyl PalMitoleate Chemical Properties |
| Boiling point | 402.3±28.0 °C(Predicted) | | density | 0.950±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | oil | | color | colorless to light yellow | | InChI | 1S/C19H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(20)22-17-18-16-21-18/h7-8,18H,2-6,9-17H2,1H3/b8-7- | | InChIKey | FWEHVPCBXKCYHE-FPLPWBNLSA-N | | SMILES | CCCCCC\C=C/CCCCCCCC(=O)OCC1CO1 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Glycidyl PalMitoleate Usage And Synthesis |
| Uses | Glycidyl 9-Hexadecenoate (UCM 710) is a dual inhibitor of α/β-hydrolase domain 6 and fatty acid amide hydrolase which augments both N-arachidonoylethanolamine and 2-arachidonoylglycerol levels in neurons. | | Biological Activity | UCM710 is a dual inhibitor of fatty acid amide hydrolase (FAAH) and α/β hydrolase domain 6 (ABHD6) the enzymes th at hydrolyze endocannabinoids. UCM710 augments both N-arachidonoylethanolamine (AEA) and 2-arachidonoylglycerol (2-AG) levels in neurons. UCM710 does not inhibit monoacylglycerol lipase (MAGL). |
| | Glycidyl PalMitoleate Preparation Products And Raw materials |
|