|
|
| | 4-Methoxytriphenylmethyl chloride Basic information |
| Product Name: | 4-Methoxytriphenylmethyl chloride | | Synonyms: | 4-METHOXY TRITYL CLHORIDE;penta anisylchlorodiphenyl methane;4-Methoxtrityl chlorid, 4-Methoxytriphenylmethyl chloride;4-Methoxytrityl Chloride [Hydroxyl Protecting Agent];Monomethoxytrityl Chloride;4-Methoxytriphenylchloromethane, 4-Methoxytrityl chloride, p-Anisylchlorodiphenylmethane, p-Monomethoxytrityl chloride;4-Methoxytriphenylchloromethane, 4-Methoxytrityl chloride, p-Anisylchlorodiphenylmethane;4-Methoxytrityl chloride (MMT-Cl) | | CAS: | 14470-28-1 | | MF: | C20H17ClO | | MW: | 308.8 | | EINECS: | 238-463-8 | | Product Categories: | Aliphatics;Halides;Biochemistry;Nucleosides, Nucleotides & Related Reagents;Protecting Agents for Hydroxyl and Amino Groups;Protecting Agents, Phosphorylating Agents & Condensing Agents;Protection & Derivatization Reagents (for Synthesis);Synthetic Organic Chemistry;OLED materials,pharm chemical,electronic | | Mol File: | 14470-28-1.mol |  |
| | 4-Methoxytriphenylmethyl chloride Chemical Properties |
| Melting point | 122-124 °C(lit.) | | Boiling point | 423.55°C (rough estimate) | | density | 1.0704 (rough estimate) | | refractive index | 1.4530 (estimate) | | storage temp. | 2-8°C | | solubility | Soluble in toluene. | | form | crystalline | | color | off-white to pink | | Sensitive | Moisture Sensitive | | BRN | 798425 | | InChI | InChI=1S/C20H17ClO/c1-22-19-14-12-18(13-15-19)20(21,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15H,1H3 | | InChIKey | OBOHMJWDFPBPKD-UHFFFAOYSA-N | | SMILES | C1(C(Cl)(C2=CC=CC=C2)C2=CC=CC=C2)=CC=C(OC)C=C1 | | CAS DataBase Reference | 14470-28-1(CAS DataBase Reference) | | NIST Chemistry Reference | P-anisylchlorodiphenylmethane(14470-28-1) |
| | 4-Methoxytriphenylmethyl chloride Usage And Synthesis |
| Description | 4-Methoxytriphenylmethyl chloride is an important organic intermediate compound, which can be used as an organic synthetic material or reaction reagent for the preparation of a group of cyclic polypeptide compounds, phosphoramidite nucleoside derivatives, nanomaterials and their antiviral drugs. | | Chemical Properties | PALE YELLOW TO YELLOW-BEIGE OR PINK CRYST. POWDER | | Uses | 4-Methoxytriphenylmethyl chloride is used in the synthesis of N-sulfonyl imines. | | Uses | It is used as selective protecting reagent that is used for primary hydroxyl groups. | | Hazard | Skin and eye irritant. |
| | 4-Methoxytriphenylmethyl chloride Preparation Products And Raw materials |
|