|
|
| | Dolutegravir SR Isomer Basic information |
| Product Name: | Dolutegravir SR Isomer | | Synonyms: | IMpurity of Dolutegravir;Dolutegravir SR Isomer;Dolutegravir impurity 6/Dolutegravir SR Isomer/(4S,12aR)-N-(2,4-Difluorobenzyl)-7-hydroxy-4-methyl-6,8-dioxo-3,4,6,8,12,12a-hexahydro-2H-pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazine-9-carboxamide;Dolutegravir (S,R)-lsomer;2H-Pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazine-9-carboxamide, N-[(2,4-difluorophenyl)methyl]-3,4,6,8,12,12a-hexahydro-7-hydroxy-4-methyl-6,8-dioxo-, (4S,12aR)-;(4S,12aR)-N-(2,4-difluorobenzyl)-7-hydroxy-4-methyl-6,8-dioxo-3,4,6,8,12,12a-hexahydro-2H-pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazine-9-carboxamide;Dolutegravir Impurity 41;Doultegravirr SR Isomer | | CAS: | 1309560-49-3 | | MF: | C20H19F2N3O5 | | MW: | 419.38 | | EINECS: | | | Product Categories: | | | Mol File: | 1309560-49-3.mol |  |
| | Dolutegravir SR Isomer Chemical Properties |
| Boiling point | 669.0±55.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | pka | 4.50±1.00(Predicted) | | InChIKey | RHWKPHLQXYSBKR-ZUZCIYMTSA-N | | SMILES | O1CC[C@H](C)N2C(=O)C3=C(O)C(=O)C(C(NCC4=CC=C(F)C=C4F)=O)=CN3C[C@@]12[H] |
| | Dolutegravir SR Isomer Usage And Synthesis |
| Uses | Dolutegravir SR Isomer is an isomeric derivative of Dolutegravir (D528800), a second generation HIV-1 integrase strand transfer inhibitor. Dolutegravir is currently in Phase III clinical trials for the treatment of HIV infection. Dolutegravir has been shown to potently inhibit HIV replication in cells such as peripheral blood mononuclear cells (PBMCs), MT-4 cells and CIP4 cells infected with a self-inactivating PHIV lentiviral vector. Dolutegravir SR Isomer. |
| | Dolutegravir SR Isomer Preparation Products And Raw materials |
|