| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1,7-Dimethylxanthine-[D6] (paraxanthine) Basic information |
| Product Name: | 1,7-Dimethylxanthine-[D6] (paraxanthine) | | Synonyms: | 1,7-Dimethylxanthine-[D6] (paraxanthine);1,7-Dimethylxanthine-(dimethyl-d6)
;1,7-DIMETHYLXANTHINE (PARAXATHINE) (DIMETHYL-D6, 98%) 97% CHEMICAL PURITY;1,7-DIMETHYLXANTHINE (PARAXANTHINE) (DIMETHYL-D6, 98%) 97% CHEMICAL PURITY;Paraxanthine-d6;1,7-Dimethylxanthine (Paraxathine, Dimethyl-d6);1,7-bis(trideuteriomethyl)-3H-purine-2,6-dione;1,7-Dimethylxanthine-(dimethyl-d?) | | CAS: | 117490-41-2 | | MF: | C7H8N4O2 | | MW: | 180.17 | | EINECS: | | | Product Categories: | | | Mol File: | 117490-41-2.mol | ![1,7-Dimethylxanthine-[D6] (paraxanthine) Structure](CAS/20180808/GIF/117490-41-2.gif) |
| | 1,7-Dimethylxanthine-[D6] (paraxanthine) Chemical Properties |
| Melting point | 294-296°C | | storage temp. | -20°C | | solubility | DMF: 10 mg/ml,DMSO: 10 mg/ml,Ethanol: 1 mg/ml,PBS (pH 7.2): 1 mg/ml | | form | A crystalline solid | | color | White to off-white | | InChI | 1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h3H,1-2H3,(H,9,13)/i1D3,2D3 | | InChIKey | QUNWUDVFRNGTCO-WFGJKAKNSA-N | | SMILES | [2H]C([2H])([2H])N1C(=O)Nc2ncn(c2C1=O)C([2H])([2H])[2H] |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1,7-Dimethylxanthine-[D6] (paraxanthine) Usage And Synthesis |
| Uses | 1,7-Dimethylxanthine (Paraxathine) (Dimethyl-D6, 98%) is an isotopic labeled compound of Paraxanthine (P192500). Paraxanthine is an adenosine receptor ligand and a major metabolite of caffeine. |
| | 1,7-Dimethylxanthine-[D6] (paraxanthine) Preparation Products And Raw materials |
|