|
|
| | (R)-(-)-Glycidyl-4-nitrobenzenesulfonate Basic information |
| Product Name: | (R)-(-)-Glycidyl-4-nitrobenzenesulfonate | | Synonyms: | (R)-(-)-GLYCIDYL-4-NITROBENZENESULFONATE 99+%;(R)-(-)-Glycidyl-4-nitrobenzenesulfonate;(R)-(-)-Glycidyl-4-nitrobenzenesulfonate 97%;Glycidyl (R)-(-)-4-nitrobenzenesulfonate, 97+%;Benzenesulfonic acid, 4-nitro-, (2R)-2-oxiranylMethyl ester;Glycidyl (R)-(-)-4-nitrobenzenesulfonate;(R)-Oxiran-2-ylmethyl 4-nitrobenzenesulfonate | | CAS: | 123750-60-7 | | MF: | C9H9NO6S | | MW: | 259.24 | | EINECS: | | | Product Categories: | Heterocyclic Compounds | | Mol File: | 123750-60-7.mol |  |
| | (R)-(-)-Glycidyl-4-nitrobenzenesulfonate Chemical Properties |
| InChI | InChI=1S/C9H9NO6S/c11-10(12)7-1-3-9(4-2-7)17(13,14)16-6-8-5-15-8/h1-4,8H,5-6H2/t8-/m1/s1 | | InChIKey | CXYDYDCHYJXOEY-MRVPVSSYSA-N | | SMILES | C1(S(OC[C@H]2CO2)(=O)=O)=CC=C([N+]([O-])=O)C=C1 |
| | (R)-(-)-Glycidyl-4-nitrobenzenesulfonate Usage And Synthesis |
| Uses | R-Glycidyl Nosylate is used as the chiral pool reactant to prepare C3-symmetric precursor 9. |
| | (R)-(-)-Glycidyl-4-nitrobenzenesulfonate Preparation Products And Raw materials |
|