| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Amino[(3,4-dichlorobenzyl)sulfanyl]methaniminium chloride manufacturers
|
| | Amino[(3,4-dichlorobenzyl)sulfanyl]methaniminium chloride Basic information |
| Product Name: | Amino[(3,4-dichlorobenzyl)sulfanyl]methaniminium chloride | | Synonyms: | [AMINO[(3,4-DICHLOROBENZYL)THIO]METHYLIDENE]AMMONIUM CHLORIDE;2-(3,4-Dichloro-benzyl)-isothiourea hydrochloride;2-(3,4-dichlorophenyl)methylcarbamimidothioate hydrochloride;A22 hydrochloride;MreB Perturbing Compound A22;S-(3,4-Dichlorobenzyl)isothiourea hydrochloride;Carbamimidothioic acid,(3,4-dichlorophenyl)methyl ester, hydrochloride (1:1);MreB Perturbing Compound A22 - CAS 22816-60-0 - Calbiochem | | CAS: | 22816-60-0 | | MF: | C8H9Cl3N2S | | MW: | 271.59 | | EINECS: | | | Product Categories: | | | Mol File: | 22816-60-0.mol | ![Amino[(3,4-dichlorobenzyl)sulfanyl]methaniminium chloride Structure](CAS/GIF/22816-60-0.gif) |
| | Amino[(3,4-dichlorobenzyl)sulfanyl]methaniminium chloride Chemical Properties |
| Melting point | 210 °C | | storage temp. | 2-8°C | | solubility | H2O: soluble2mg/mL (clear solution, warmed) | | form | White solid | | color | white to beige | | Water Solubility | water: 2mg/mL DMSO: 200mg/mL | | InChI | 1S/C8H8Cl2N2S.ClH/c9-6-2-1-5(3-7(6)10)4-13-8(11)12;/h1-3H,4H2,(H3,11,12);1H | | InChIKey | VBJNMXMOMSWRDV-UHFFFAOYSA-N | | SMILES | Cl.NC(=N)SCc1ccc(Cl)c(Cl)c1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids |
| | Amino[(3,4-dichlorobenzyl)sulfanyl]methaniminium chloride Usage And Synthesis |
| Uses | MreB Perturbing Compound A22 is an isothiourea that reversibly perturbs MreB function. | | Biochem/physiol Actions | A22 is an inhibitor of MreB, an actin-like bacterial protein, and has been shown to act as an antiobiotic adjuvant. A22 inhibition of MreB disrupts the bacterial actin cytoskeleton, which can cause an increase in cell permeability and altered transport. A22 has been shown to have synergistic effects with several antibiotics including novobiocin and rifampin in gram negative bacteria. |
| | Amino[(3,4-dichlorobenzyl)sulfanyl]methaniminium chloride Preparation Products And Raw materials |
|