| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 1,3-PROPANE-D6-DIAMINE Basic information |
| Product Name: | 1,3-PROPANE-D6-DIAMINE | | Synonyms: | 1,3-PROPANE-D6-DIAMINE;1,3-Propane-1,1,2,2,3,3-d6-diamine;1,3-Diamino(propane-d6);1,3-Diamino(propane-d6) | | CAS: | 90375-98-7 | | MF: | C3H10N2 | | MW: | 74.13 | | EINECS: | | | Product Categories: | | | Mol File: | 90375-98-7.mol |  |
| | 1,3-PROPANE-D6-DIAMINE Chemical Properties |
| Melting point | -12 °C(lit.) | | Boiling point | 140 °C(lit.) | | density | 0.959 g/mL at 25 °C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Oil | | color | Clear Colourless | | InChI | 1S/C3H10N2/c4-2-1-3-5/h1-5H2/i1D2,2D2,3D2 | | InChIKey | XFNJVJPLKCPIBV-NMFSSPJFSA-N | | SMILES | [2H]C([2H])(N)C([2H])([2H])C([2H])([2H])N |
| Hazard Codes | T,C | | Risk Statements | 10-22-24-35 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2922 8/PG 2 | | WGK Germany | WGK 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 2 Dermal
Acute Tox. 4 Oral
Eye Dam. 1
Flam. Liq. 3
Met. Corr. 1
Resp. Sens. 1B
Skin Corr. 1B
Skin Sens. 1B |
| | 1,3-PROPANE-D6-DIAMINE Usage And Synthesis |
| Uses | 1,3-Diaminopropane-d6 is the isotope labelled analog of 1,3-Diaminopropane. 1,3-Diaminopropane is a common chemical reagent, used in the synthesis of 7-methoxytacrine-adamantylamine heterodimers as cholinesterase inhibitors applied in the treatment of Alzheimer’s disease. Also used in the synthesis of thrombosis inhibitors. |
| | 1,3-PROPANE-D6-DIAMINE Preparation Products And Raw materials |
|