| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | 6-Bromo-3,4-dihydro-4-(3,4,5-trimethoxyphenyl)-benzo[h]quinolin-2(1H)-one Basic information |
| Product Name: | 6-Bromo-3,4-dihydro-4-(3,4,5-trimethoxyphenyl)-benzo[h]quinolin-2(1H)-one | | Synonyms: | 6-B345TTQ;6-Bromo-3,4-dihydro-4-(3,4,5-trimethoxyphenyl)-benzo[h]quinolin-2(1H)-one;Benzo[h]quinolin-2(1H)-one, 6-bromo-3,4-dihydro-4-(3,4,5-trimethoxyphenyl)-;6-B345TTQ >98% (HPLC) | | CAS: | 297157-87-0 | | MF: | C22H20BrNO4 | | MW: | 442.3 | | EINECS: | | | Product Categories: | | | Mol File: | 297157-87-0.mol | ![6-Bromo-3,4-dihydro-4-(3,4,5-trimethoxyphenyl)-benzo[h]quinolin-2(1H)-one Structure](CAS/20180703/GIF/297157-87-0.gif) |
| | 6-Bromo-3,4-dihydro-4-(3,4,5-trimethoxyphenyl)-benzo[h]quinolin-2(1H)-one Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: ≥20mg/mL | | form | powder | | color | white to off-white | | InChI | 1S/C22H20BrNO4/c1-26-18-8-12(9-19(27-2)22(18)28-3)15-11-20(25)24-21-14-7-5-4-6-13(14)17(23)10-16(15)21/h4-10,15H,11H2,1-3H3,(H,24,25) | | InChIKey | KPOXOTVERMGJQS-UHFFFAOYSA-N | | SMILES | COc1cc(cc(OC)c1OC)C2CC(=O)Nc3c2cc(Br)c4ccccc34 |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | 6-Bromo-3,4-dihydro-4-(3,4,5-trimethoxyphenyl)-benzo[h]quinolin-2(1H)-one Usage And Synthesis |
| Uses | 6-B345TTQ is an α4 integrin inhibitor that inhibits α4-Leupaxin interaction. 6-B345TTQ can be used in inflammation research[1]. | | Biological Activity | 6-B345TTQ is a non-cytotoxic inhibitor of α4 integrin paxillin interaction. | | References | [1] Kummer C, et al. A small molecule that inhibits the interaction of paxillin and alpha 4 integrin inhibits accumulation of mononuclear leukocytes at a site of inflammation. J Biol Chem. 2010 Mar 26;285(13):9462-9469. DOI:10.1074/jbc.M109.066993 |
| | 6-Bromo-3,4-dihydro-4-(3,4,5-trimethoxyphenyl)-benzo[h]quinolin-2(1H)-one Preparation Products And Raw materials |
|