- Diacetin
-
- $6.00
-
2026-08-20
- CAS:25395-31-7
- Min. Order: 1KG
- Purity: 99%
- Diacetin
-
- $100.00
-
2026-05-28
- CAS:25395-31-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
- Diacetin
-
- $10.00
-
2026-03-20
- CAS:25395-31-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | Diacetin Basic information |
| Product Name: | Diacetin | | Synonyms: | 2-(Acetyloxy)-1-(hydroxymethyl)ethyl acetate;Acetin, di-;Carset 533;Carset 555;Diacetin FCC;Diacetin,mixedisomers,tech.60%;GLYCERIL-ALPHA,ALPHA'-DIACETATE;GLYCEROLMONO-ANDDIACETATES | | CAS: | 25395-31-7 | | MF: | C7H12O5 | | MW: | 176.17 | | EINECS: | 246-941-2 | | Product Categories: | | | Mol File: | 25395-31-7.mol |  |
| | Diacetin Chemical Properties |
| Melting point | -30 °C | | Boiling point | 280 °C | | density | 1.17 g/mL at 25 °C (lit.) | | vapor density | 6.1 (vs air) | | vapor pressure | <1 mm Hg ( 20 °C) | | refractive index | n20/D 1.440(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | alcohol: soluble(lit.) | | form | Liquid | | color | Clear colorless | | PH | 5-6 (50g/l, H2O, 20℃) | | Odor | at 100.00 %. very mild alcoholic | | Odor Type | alcoholic | | biological source | synthetic | | Water Solubility | Soluble in water, alcohol, ether, benzene | | Sensitive | Hygroscopic | | Merck | 14,2961 | | BRN | 1706903 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | SOLVENT | | InChI | 1S/2C7H12O5/c1-5(8)11-3-7(10)4-12-6(2)9;1-5(9)11-4-7(3-8)12-6(2)10/h7,10H,3-4H2,1-2H3;7-8H,3-4H2,1-2H3 | | InChIKey | TWSUHSVPDUPKDH-UHFFFAOYSA-N | | SMILES | CC(=O)OCC(O)COC(C)=O.CC(=O)OCC(CO)OC(C)=O | | LogP | -0.640 | | CAS DataBase Reference | 25395-31-7(CAS DataBase Reference) | | NIST Chemistry Reference | 1,2,3-Propanetriol, diacetate(25395-31-7) | | EPA Substance Registry System | 1,2,3-Propanetriol, diacetate (25395-31-7) |
| Safety Statements | 24/25 | | WGK Germany | 1 | | RTECS | AK3325000 | | F | 3 | | TSCA | TSCA listed | | HS Code | 29153930 | | Storage Class | 10 - Combustible liquids | | Toxicity | dog,LD50,intravenous,3gm/kg (3000mg/kg),"Prehled Prumyslove Toxikologie; Organicke Latky," Marhold, J., Prague, Czechoslovakia, Avicenum, 1986Vol. -, Pg. 667, 1986. |
| | Diacetin Usage And Synthesis |
| Chemical Properties | clear liquid | | Uses | Diacetin is used as a solvent, plasticizer, and softening agent. | | Uses | Diacetin has been used to design and evaluate gliclazide push-pull osmotic pump (PPOP) coated with aqueous colloidal polymer dispersions. | | Definition | ChEBI: A diglyceride resulting from the formal condensation of any two of the hydroxy groups of glycerol with the carboxy groups of two molecules of acetic acid (either R1 = H and R2 = Ac, or R1 = Ac and R2 = H). | | General Description | Diacetin is widely used as plasticizer. | | Synthesis | Prod.: 1) from Glycerin with 2 mol. Acetic acid. 2) from AHYIacetate uith Hypoiodous acid,
followed by reaction with Potassium
acetate. |
| | Diacetin Preparation Products And Raw materials |
|