| Company Name: |
BioPharmaMatrix,Inc.
|
| Tel: |
0510-86010668 |
| Email: |
sales@biopharmamatrix.com |
| Products Intro: |
CAS:1048025-60-0
Package:5g
|
| Company Name: |
Pushan Industry (Shaanxi) Co., Ltd.
|
| Tel: |
029-81310890 13571859809 |
| Email: |
info@pushanshiye.com |
| Products Intro: |
Product Name:4-Fluoro-2-iodo-6-methylbenzoic acid
CAS:1048025-60-0
Purity:97% Package:25kg
|
|
| | 4-Fluoro-2-iodo-6-methylbenzoic acid Basic information |
| | 4-Fluoro-2-iodo-6-methylbenzoic acid Chemical Properties |
| InChI | 1S/C8H6FIO2/c1-4-2-5(9)3-6(10)7(4)8(11)12/h2-3H,1H3,(H,11,12) | | InChIKey | XPERIYDUXDEQLZ-UHFFFAOYSA-N | | SMILES | CC1=C(C(O)=O)C(I)=CC(F)=C1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4-Fluoro-2-iodo-6-methylbenzoic acid Usage And Synthesis |
| reaction suitability | reagent type: ligand
reaction type: C-H Activation |
| | 4-Fluoro-2-iodo-6-methylbenzoic acid Preparation Products And Raw materials |
|