|
|
| | Ethyl 5-(4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate Basic information |
| Product Name: | Ethyl 5-(4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate | | Synonyms: | Ethyl 5-(4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate;JR-13676, Ethyl 5-(4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate, 95%;1,3,4-Oxadiazole-2-carboxylic acid, 5-(4-chlorophenyl)-, ethyl ester | | CAS: | 68496-88-8 | | MF: | C11H9ClN2O3 | | MW: | 252.65 | | EINECS: | | | Product Categories: | | | Mol File: | 68496-88-8.mol |  |
| | Ethyl 5-(4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate Chemical Properties |
| storage temp. | Store at room temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C11H9ClN2O3/c1-2-16-11(15)10-14-13-9(17-10)7-3-5-8(12)6-4-7/h3-6H,2H2,1H3 | | InChIKey | HZJHKOBSCAWAOC-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1nnc(o1)-c2ccc(Cl)cc2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 5-(4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate Usage And Synthesis |
| | Ethyl 5-(4-chlorophenyl)-1,3,4-oxadiazole-2-carboxylate Preparation Products And Raw materials |
|