|
|
| | 3-Dimethylamino-2-methylpropyl chloride hydrochloride Basic information |
| | 3-Dimethylamino-2-methylpropyl chloride hydrochloride Chemical Properties |
| Melting point | 169-173 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly), Water (Slightly) | | form | Powder | | color | White to off-white | | Sensitive | Hygroscopic | | BRN | 4444785 | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H14ClN.ClH/c1-6(4-7)5-8(2)3;/h6H,4-5H2,1-3H3;1H | | InChIKey | SOMIBONUMGNAEP-UHFFFAOYSA-N | | SMILES | C(C)(CCl)CN(C)C.Cl | | CAS DataBase Reference | 4261-67-0(CAS DataBase Reference) |
| | 3-Dimethylamino-2-methylpropyl chloride hydrochloride Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | Cyamemazine intermediate. |
| | 3-Dimethylamino-2-methylpropyl chloride hydrochloride Preparation Products And Raw materials |
|