|
|
| | 4-(TERT-BUTYL)-2-CHLOROANILINE Basic information |
| Product Name: | 4-(TERT-BUTYL)-2-CHLOROANILINE | | Synonyms: | 4-(TERT-BUTYL)-2-CHLOROANILINE;4-t-butyl-2-chloroaniline;Benzenamine, 2-chloro-4-(1,1-dimethylethyl)-;2-chloro-4-tert-butylaniline;4-Uncle Butyl-2-ChloroAniline | | CAS: | 42265-67-8 | | MF: | C10H14ClN | | MW: | 183.68 | | EINECS: | | | Product Categories: | | | Mol File: | 42265-67-8.mol |  |
| | 4-(TERT-BUTYL)-2-CHLOROANILINE Chemical Properties |
| Boiling point | 84 °C | | density | 1.078±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.98±0.10(Predicted) | | form | low melting solid | | color | Colourless to light brown | | InChI | InChI=1S/C10H14ClN/c1-10(2,3)7-4-5-9(12)8(11)6-7/h4-6H,12H2,1-3H3 | | InChIKey | MFEZEFHCSBXPPO-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C(C)(C)C)C=C1Cl |
| | 4-(TERT-BUTYL)-2-CHLOROANILINE Usage And Synthesis |
| Synthesis | N-(4-(tert-butyl)-2-chlorophenyl)acetamide was used as starting material, and the acetyl deprotection reaction was carried out by treating with 20% aqueous hydrochloric acid overnight to obtain the target product 4-tert-butyl-2-chloroaniline, which was a reddish oily material with a yield of 75%. | | References | [1] Patent: WO2011/120604, 2011, A1. Location in patent: Page/Page column 111; 132
[2] Patent: WO2005/118575, 2005, A1. Location in patent: Page/Page column 79
[3] Journal of Organic Chemistry, 1956, vol. 21, p. 736 |
| | 4-(TERT-BUTYL)-2-CHLOROANILINE Preparation Products And Raw materials |
|