(1r,3s)-3-amino-1-(boc-amino)cyclohexane manufacturers
|
| | (1r,3s)-3-amino-1-(boc-amino)cyclohexane Basic information |
| Product Name: | (1r,3s)-3-amino-1-(boc-amino)cyclohexane | | Synonyms: | (1r,3s)-3-amino-1-(boc-amino)cyclohexane;Carbamic acid,N-[(1R,3S)-3-aminocyclohexyl]-, 1,1-dimethylethyl ester;tert-Butyl ((1R,3S)-3-aminocyclohexyl)carbamate;tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate;2-Methyl-2-propanyl [(1R,3S)-3-aminocyclohexyl]carbamate;rac-tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate, cis | | CAS: | 1259278-17-5 | | MF: | C11H22N2O2 | | MW: | 214.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1259278-17-5.mol |  |
| | (1r,3s)-3-amino-1-(boc-amino)cyclohexane Chemical Properties |
| Boiling point | 322.1±31.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 12.40±0.40(Predicted) | | Appearance | Off-white to light yellow Solid | | Optical Rotation | 30.599°(C=0.01g/mL, MEOH, 20°C, 589nm) | | InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-9-6-4-5-8(12)7-9/h8-9H,4-7,12H2,1-3H3,(H,13,14)/t8-,9+/m0/s1 | | InChIKey | OBSACSBMTRJNPH-DTWKUNHWSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CCC[C@H](N)C1 |
| | (1r,3s)-3-amino-1-(boc-amino)cyclohexane Usage And Synthesis |
| | (1r,3s)-3-amino-1-(boc-amino)cyclohexane Preparation Products And Raw materials |
|